C36H54O11 — CID 6279153
(2E,6E,8Z)-10-[9-butyl-8-[(E)-4-carboxy-3-methylbut-3-enyl]-9-(3-carboxypropanoyloxy)-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-5-hydroxy-4,8-dimethyldeca-2,6,8-trienoic acid (PubChem CID 6279153) has the molecular formula C36H54O11 and a molecular weight of 662.82 g/mol. Its IUPAC name is (2E,6E,8Z)-10-[9-butyl-8-[(E)-4-carboxy-3-methylbut-3-enyl]-9-(3-carboxypropanoyloxy)-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-5-hydroxy-4,8-dimethyldeca-2,6,8-trienoic acid.
| Compound Name | (2E,6E,8Z)-10-[9-butyl-8-[(E)-4-carboxy-3-methylbut-3-enyl]-9-(3-carboxypropanoyloxy)-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-5-hydroxy-4,8-dimethyldeca-2,6,8-trienoic acid |
|---|---|
| PubChem CID | 6279153 |
| Molecular Formula | C36H54O11 |
| Molecular Weight | 662.82 g/mol |
| Exact Mass | 662.37 |
| IUPAC Name | (2E,6E,8Z)-10-[9-butyl-8-[(E)-4-carboxy-3-methylbut-3-enyl]-9-(3-carboxypropanoyloxy)-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]-5-hydroxy-4,8-dimethyldeca-2,6,8-trienoic acid |
| SMILES | CCCCC1(OC(=O)CCC(=O)O)CCC2(CCC(C)C(C/C=C(C)\C=C\C(O)C(C)/C=C/C(=O)O)O2)OC1CC/C(C)=C/C(=O)O |
| InChI | InChI=1S/C36H54O11/c1-6-7-19-35(47-34(44)17-16-32(40)41)21-22-36(46-30(35)14-10-25(3)23-33(42)43)20-18-27(5)29(45-36)13-9-24(2)8-12-28(37)26(4)11-15-31(38)39/h8-9,11-12,15,23,26-30,37H,6-7,10,13-14,16-22H2,1-5H3,(H,38,39)(H,40,41)(H,42,43)/b12-8+,15-11+,24-9-,25-23+ |
| InChIKey | WBKGGGSUUMPJST-PXGHNPTFSA-N |
| XLogP | 6.36 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.82 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|