About 3-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-1,3-thiazolidine-4-carboxylic acid
3-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 62792239) has the molecular formula C9H11N3O3S2
and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 62792239 |
| Molecular Formula | C9H11N3O3S2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 3-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | Cc1nc(N)sc1C(=O)N1CSCC1C(=O)O |
| InChI | InChI=1S/C9H11N3O3S2/c1-4-6(17-9(10)11-4)7(13)12-3-16-2-5(12)8(14)15/h5H,2-3H2,1H3,(H2,10,11)(H,14,15) |
| InChIKey | BSERONSTLXGLLT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 3-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-1,3-thiazolidine-4-carboxylic acid (CID 62792239) is 3-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 3-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 3-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-1,3-thiazolidine-4-carboxylic acid is Cc1nc(N)sc1C(=O)N1CSCC1C(=O)O.
What is the InChIKey of 3-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is BSERONSTLXGLLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O3S2/c1-4-6(17-9(10)11-4)7(13)12-3-16-2-5(12)8(14)15/h5H,2-3H2,1H3,(H2,10,11)(H,14,15).
What are the key properties of 3-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-1,3-thiazolidine-4-carboxylic acid?
3-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 273.34 g/mol, XLogP of 0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 62792239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).