About ethyl 2-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-(2-methoxyethyl)amino]acetate
ethyl 2-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-(2-methoxyethyl)amino]acetate (PubChem CID 62792408) has the molecular formula C12H19N3O4S
and a molecular weight of 301.37 g/mol. Its IUPAC name is ethyl 2-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-(2-methoxyethyl)amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-(2-methoxyethyl)amino]acetate |
| PubChem CID | 62792408 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | ethyl 2-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-(2-methoxyethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)C(=O)c1sc(N)nc1C |
| InChI | InChI=1S/C12H19N3O4S/c1-4-19-9(16)7-15(5-6-18-3)11(17)10-8(2)14-12(13)20-10/h4-7H2,1-3H3,(H2,13,14) |
| InChIKey | LVBGCOSPXKAPAP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-(2-methoxyethyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-(2-methoxyethyl)amino]acetate?
The IUPAC name of ethyl 2-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-(2-methoxyethyl)amino]acetate (CID 62792408) is ethyl 2-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-(2-methoxyethyl)amino]acetate.
What is the SMILES notation for ethyl 2-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-(2-methoxyethyl)amino]acetate?
The canonical SMILES for ethyl 2-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-(2-methoxyethyl)amino]acetate is CCOC(=O)CN(CCOC)C(=O)c1sc(N)nc1C.
What is the InChIKey of ethyl 2-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-(2-methoxyethyl)amino]acetate?
The InChIKey is LVBGCOSPXKAPAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O4S/c1-4-19-9(16)7-15(5-6-18-3)11(17)10-8(2)14-12(13)20-10/h4-7H2,1-3H3,(H2,13,14).
What are the key properties of ethyl 2-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-(2-methoxyethyl)amino]acetate?
ethyl 2-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-(2-methoxyethyl)amino]acetate has a molecular weight of 301.37 g/mol, XLogP of 0.69, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-(2-methoxyethyl)amino]acetate is sourced from PubChem (CID 62792408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).