C10H16F3N5O2 — CID 62792644
3-amino-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 62792644) has the molecular formula C10H16F3N5O2 and a molecular weight of 295.26 g/mol. Its IUPAC name is 3-amino-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 62792644 |
| Molecular Formula | C10H16F3N5O2 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 3-amino-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CCOCCCN(CC(F)(F)F)C(=O)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C10H16F3N5O2/c1-2-20-5-3-4-18(6-10(11,12)13)8(19)7-15-9(14)17-16-7/h2-6H2,1H3,(H3,14,15,16,17) |
| InChIKey | WCRNJEORGGIKDF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|