About 3-amino-N-(cyclohexylmethyl)-N-cyclopropyl-1H-1,2,4-triazole-5-carboxamide
3-amino-N-(cyclohexylmethyl)-N-cyclopropyl-1H-1,2,4-triazole-5-carboxamide (PubChem CID 62793339) has the molecular formula C13H21N5O
and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-amino-N-(cyclohexylmethyl)-N-cyclopropyl-1H-1,2,4-triazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-(cyclohexylmethyl)-N-cyclopropyl-1H-1,2,4-triazole-5-carboxamide |
| PubChem CID | 62793339 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 3-amino-N-(cyclohexylmethyl)-N-cyclopropyl-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Nc1n[nH]c(C(=O)N(CC2CCCCC2)C2CC2)n1 |
| InChI | InChI=1S/C13H21N5O/c14-13-15-11(16-17-13)12(19)18(10-6-7-10)8-9-4-2-1-3-5-9/h9-10H,1-8H2,(H3,14,15,16,17) |
| InChIKey | RASSVVFQFZXUDL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-N-(cyclohexylmethyl)-N-cyclopropyl-1H-1,2,4-triazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(cyclohexylmethyl)-N-cyclopropyl-1H-1,2,4-triazole-5-carboxamide?
The IUPAC name of 3-amino-N-(cyclohexylmethyl)-N-cyclopropyl-1H-1,2,4-triazole-5-carboxamide (CID 62793339) is 3-amino-N-(cyclohexylmethyl)-N-cyclopropyl-1H-1,2,4-triazole-5-carboxamide.
What is the SMILES notation for 3-amino-N-(cyclohexylmethyl)-N-cyclopropyl-1H-1,2,4-triazole-5-carboxamide?
The canonical SMILES for 3-amino-N-(cyclohexylmethyl)-N-cyclopropyl-1H-1,2,4-triazole-5-carboxamide is Nc1n[nH]c(C(=O)N(CC2CCCCC2)C2CC2)n1.
What is the InChIKey of 3-amino-N-(cyclohexylmethyl)-N-cyclopropyl-1H-1,2,4-triazole-5-carboxamide?
The InChIKey is RASSVVFQFZXUDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5O/c14-13-15-11(16-17-13)12(19)18(10-6-7-10)8-9-4-2-1-3-5-9/h9-10H,1-8H2,(H3,14,15,16,17).
What are the key properties of 3-amino-N-(cyclohexylmethyl)-N-cyclopropyl-1H-1,2,4-triazole-5-carboxamide?
3-amino-N-(cyclohexylmethyl)-N-cyclopropyl-1H-1,2,4-triazole-5-carboxamide has a molecular weight of 263.34 g/mol, XLogP of 1.57, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(cyclohexylmethyl)-N-cyclopropyl-1H-1,2,4-triazole-5-carboxamide is sourced from PubChem (CID 62793339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).