About 2-amino-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide
2-amino-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 62793778) has the molecular formula C12H19N3O4S2
and a molecular weight of 333.44 g/mol. Its IUPAC name is 2-amino-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 62793778 |
| Molecular Formula | C12H19N3O4S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-amino-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | COCCN(C(=O)c1sc(N)nc1C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H19N3O4S2/c1-8-10(20-12(13)14-8)11(16)15(4-5-19-2)9-3-6-21(17,18)7-9/h9H,3-7H2,1-2H3,(H2,13,14) |
| InChIKey | NMLFWXDJLKNGLG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-amino-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide (CID 62793778) is 2-amino-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-amino-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-amino-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide is COCCN(C(=O)c1sc(N)nc1C)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-amino-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide?
The InChIKey is NMLFWXDJLKNGLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O4S2/c1-8-10(20-12(13)14-8)11(16)15(4-5-19-2)9-3-6-21(17,18)7-9/h9H,3-7H2,1-2H3,(H2,13,14).
What are the key properties of 2-amino-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide?
2-amino-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide has a molecular weight of 333.44 g/mol, XLogP of 0.31, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(1,1-dioxothiolan-3-yl)-N-(2-methoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 62793778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).