About 2-amino-N-(2-methoxyethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide
2-amino-N-(2-methoxyethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 62794301) has the molecular formula C9H15N3O2S
and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-amino-N-(2-methoxyethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N-(2-methoxyethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 62794301 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-amino-N-(2-methoxyethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | COCCN(C)C(=O)c1sc(N)nc1C |
| InChI | InChI=1S/C9H15N3O2S/c1-6-7(15-9(10)11-6)8(13)12(2)4-5-14-3/h4-5H2,1-3H3,(H2,10,11) |
| InChIKey | HVVNVMQCMHGTSQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N-(2-methoxyethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2-methoxyethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-amino-N-(2-methoxyethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide (CID 62794301) is 2-amino-N-(2-methoxyethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-amino-N-(2-methoxyethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-amino-N-(2-methoxyethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide is COCCN(C)C(=O)c1sc(N)nc1C.
What is the InChIKey of 2-amino-N-(2-methoxyethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
The InChIKey is HVVNVMQCMHGTSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2S/c1-6-7(15-9(10)11-6)8(13)12(2)4-5-14-3/h4-5H2,1-3H3,(H2,10,11).
What are the key properties of 2-amino-N-(2-methoxyethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
2-amino-N-(2-methoxyethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide has a molecular weight of 229.30 g/mol, XLogP of 0.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2-methoxyethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 62794301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).