About (E)-4-[(1,1-dioxothiolan-3-yl)-methylamino]-4-oxobut-2-enoic acid
(E)-4-[(1,1-dioxothiolan-3-yl)-methylamino]-4-oxobut-2-enoic acid (PubChem CID 6279540) has the molecular formula C9H13NO5S
and a molecular weight of 247.27 g/mol. Its IUPAC name is (E)-4-[(1,1-dioxothiolan-3-yl)-methylamino]-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | (E)-4-[(1,1-dioxothiolan-3-yl)-methylamino]-4-oxobut-2-enoic acid |
| PubChem CID | 6279540 |
| Molecular Formula | C9H13NO5S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | (E)-4-[(1,1-dioxothiolan-3-yl)-methylamino]-4-oxobut-2-enoic acid |
| SMILES | CN(C(=O)/C=C/C(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H13NO5S/c1-10(8(11)2-3-9(12)13)7-4-5-16(14,15)6-7/h2-3,7H,4-6H2,1H3,(H,12,13)/b3-2+ |
| InChIKey | RTPGEMIHAYORPM-NSCUHMNNSA-N |
| XLogP | -0.73 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[(1,1-dioxothiolan-3-yl)-methylamino]-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[(1,1-dioxothiolan-3-yl)-methylamino]-4-oxobut-2-enoic acid?
The IUPAC name of (E)-4-[(1,1-dioxothiolan-3-yl)-methylamino]-4-oxobut-2-enoic acid (CID 6279540) is (E)-4-[(1,1-dioxothiolan-3-yl)-methylamino]-4-oxobut-2-enoic acid.
What is the SMILES notation for (E)-4-[(1,1-dioxothiolan-3-yl)-methylamino]-4-oxobut-2-enoic acid?
The canonical SMILES for (E)-4-[(1,1-dioxothiolan-3-yl)-methylamino]-4-oxobut-2-enoic acid is CN(C(=O)/C=C/C(=O)O)C1CCS(=O)(=O)C1.
What is the InChIKey of (E)-4-[(1,1-dioxothiolan-3-yl)-methylamino]-4-oxobut-2-enoic acid?
The InChIKey is RTPGEMIHAYORPM-NSCUHMNNSA-N. The full InChI is InChI=1S/C9H13NO5S/c1-10(8(11)2-3-9(12)13)7-4-5-16(14,15)6-7/h2-3,7H,4-6H2,1H3,(H,12,13)/b3-2+.
What are the key properties of (E)-4-[(1,1-dioxothiolan-3-yl)-methylamino]-4-oxobut-2-enoic acid?
(E)-4-[(1,1-dioxothiolan-3-yl)-methylamino]-4-oxobut-2-enoic acid has a molecular weight of 247.27 g/mol, XLogP of -0.73, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[(1,1-dioxothiolan-3-yl)-methylamino]-4-oxobut-2-enoic acid is sourced from PubChem (CID 6279540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).