C14H18N6O — CID 62795886
5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine (PubChem CID 62795886) has the molecular formula C14H18N6O and a molecular weight of 286.34 g/mol. Its IUPAC name is 5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 62795886 |
| Molecular Formula | C14H18N6O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(-c2nc(C34CC5CC(CC(C5)C3)C4)no2)n1 |
| InChI | InChI=1S/C14H18N6O/c15-13-16-10(18-19-13)11-17-12(20-21-11)14-4-7-1-8(5-14)3-9(2-7)6-14/h7-9H,1-6H2,(H3,15,16,18,19) |
| InChIKey | LUTILGBEVYAQBL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |