C14H18N2S — CID 62796349
1-(4-ethylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanamine (PubChem CID 62796349) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanamine.
| Compound Name | 1-(4-ethylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 62796349 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 1-(4-ethylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanamine |
| SMILES | CCc1ccc(C(N)Cc2nc(C)cs2)cc1 |
| InChI | InChI=1S/C14H18N2S/c1-3-11-4-6-12(7-5-11)13(15)8-14-16-10(2)9-17-14/h4-7,9,13H,3,8,15H2,1-2H3 |
| InChIKey | SCTMJFHFNCRWOX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |