C14H14N4OS2 — CID 62797030
3-[(4-methyl-1,3-thiazol-2-yl)methyl]-5-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-yl)-1,2,4-oxadiazole (PubChem CID 62797030) has the molecular formula C14H14N4OS2 and a molecular weight of 318.43 g/mol. Its IUPAC name is 3-[(4-methyl-1,3-thiazol-2-yl)methyl]-5-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-yl)-1,2,4-oxadiazole.
| Compound Name | 3-[(4-methyl-1,3-thiazol-2-yl)methyl]-5-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 62797030 |
| Molecular Formula | C14H14N4OS2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 3-[(4-methyl-1,3-thiazol-2-yl)methyl]-5-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-4-yl)-1,2,4-oxadiazole |
| SMILES | Cc1csc(Cc2noc(C3NCCc4sccc43)n2)n1 |
| InChI | InChI=1S/C14H14N4OS2/c1-8-7-21-12(16-8)6-11-17-14(19-18-11)13-9-3-5-20-10(9)2-4-15-13/h3,5,7,13,15H,2,4,6H2,1H3 |
| InChIKey | MGGWXMAWVYKKPJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |