C20H22N2O2 — CID 627978
5-methoxy-8,11,11-trimethyl-9-phenyl-1,9-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-10-one (PubChem CID 627978) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 5-methoxy-8,11,11-trimethyl-9-phenyl-1,9-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-10-one.
| Compound Name | 5-methoxy-8,11,11-trimethyl-9-phenyl-1,9-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-10-one |
|---|---|
| PubChem CID | 627978 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 5-methoxy-8,11,11-trimethyl-9-phenyl-1,9-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-10-one |
| SMILES | COc1ccc2c(c1)C1(C)CC(C)(C)N2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C20H22N2O2/c1-19(2)13-20(3)16-12-15(24-4)10-11-17(16)22(19)18(23)21(20)14-8-6-5-7-9-14/h5-12H,13H2,1-4H3 |
| InChIKey | KEKXZHWWNWDHNT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |