C16H19NO3 — CID 62798863
1,4-dioxan-2-yl-(4-methoxynaphthalen-1-yl)methanamine (PubChem CID 62798863) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 1,4-dioxan-2-yl-(4-methoxynaphthalen-1-yl)methanamine.
| Compound Name | 1,4-dioxan-2-yl-(4-methoxynaphthalen-1-yl)methanamine |
|---|---|
| PubChem CID | 62798863 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 1,4-dioxan-2-yl-(4-methoxynaphthalen-1-yl)methanamine |
| SMILES | COc1ccc(C(N)C2COCCO2)c2ccccc12 |
| InChI | InChI=1S/C16H19NO3/c1-18-14-7-6-13(11-4-2-3-5-12(11)14)16(17)15-10-19-8-9-20-15/h2-7,15-16H,8-10,17H2,1H3 |
| InChIKey | VVRDBSXRWVUSHS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |