About 5-methoxy-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-one
5-methoxy-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-one (PubChem CID 62798970) has the molecular formula C10H15NO2S
and a molecular weight of 213.30 g/mol. Its IUPAC name is 5-methoxy-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-one.
Molecular Properties
| Compound Name | 5-methoxy-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-one |
| PubChem CID | 62798970 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 5-methoxy-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-one |
| SMILES | COCCCC(=O)Cc1csc(C)n1 |
| InChI | InChI=1S/C10H15NO2S/c1-8-11-9(7-14-8)6-10(12)4-3-5-13-2/h7H,3-6H2,1-2H3 |
| InChIKey | DEXMZJIGYYIEPS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-one?
The IUPAC name of 5-methoxy-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-one (CID 62798970) is 5-methoxy-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-one.
What is the SMILES notation for 5-methoxy-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-one?
The canonical SMILES for 5-methoxy-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-one is COCCCC(=O)Cc1csc(C)n1.
What is the InChIKey of 5-methoxy-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-one?
The InChIKey is DEXMZJIGYYIEPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2S/c1-8-11-9(7-14-8)6-10(12)4-3-5-13-2/h7H,3-6H2,1-2H3.
What are the key properties of 5-methoxy-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-one?
5-methoxy-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-one has a molecular weight of 213.30 g/mol, XLogP of 1.99, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1-(2-methyl-1,3-thiazol-4-yl)pentan-2-one is sourced from PubChem (CID 62798970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).