C20H24N2O — CID 627994
(1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)-(1H-imidazol-2-yl)methanone (PubChem CID 627994) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is (1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)-(1H-imidazol-2-yl)methanone.
| Compound Name | (1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)-(1H-imidazol-2-yl)methanone |
|---|---|
| PubChem CID | 627994 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (1,4a-dimethyl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)-(1H-imidazol-2-yl)methanone |
| SMILES | CC1(C(=O)c2ncc[nH]2)CCCC2(C)c3ccccc3CCC12 |
| InChI | InChI=1S/C20H24N2O/c1-19-10-5-11-20(2,17(23)18-21-12-13-22-18)16(19)9-8-14-6-3-4-7-15(14)19/h3-4,6-7,12-13,16H,5,8-11H2,1-2H3,(H,21,22) |
| InChIKey | SYMXRKCCWAFQRD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |