C13H12N2O5 — CID 62799566
1,4-dioxan-2-yl-(5-nitro-1H-indol-3-yl)methanone (PubChem CID 62799566) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 1,4-dioxan-2-yl-(5-nitro-1H-indol-3-yl)methanone.
| Compound Name | 1,4-dioxan-2-yl-(5-nitro-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 62799566 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 1,4-dioxan-2-yl-(5-nitro-1H-indol-3-yl)methanone |
| SMILES | O=C(c1c[nH]c2ccc([N+](=O)[O-])cc12)C1COCCO1 |
| InChI | InChI=1S/C13H12N2O5/c16-13(12-7-19-3-4-20-12)10-6-14-11-2-1-8(15(17)18)5-9(10)11/h1-2,5-6,12,14H,3-4,7H2 |
| InChIKey | PSKROVCVRWGCAV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|