About 2-(2-amino-1,3-thiazol-4-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide
2-(2-amino-1,3-thiazol-4-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide (PubChem CID 62799994) has the molecular formula C13H17N3O2S
and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide |
| PubChem CID | 62799994 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide |
| SMILES | CC(CCc1ccco1)NC(=O)Cc1csc(N)n1 |
| InChI | InChI=1S/C13H17N3O2S/c1-9(4-5-11-3-2-6-18-11)15-12(17)7-10-8-19-13(14)16-10/h2-3,6,8-9H,4-5,7H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | ZKEQOPLHHURIPG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-amino-1,3-thiazol-4-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-1,3-thiazol-4-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide?
The IUPAC name of 2-(2-amino-1,3-thiazol-4-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide (CID 62799994) is 2-(2-amino-1,3-thiazol-4-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide.
What is the SMILES notation for 2-(2-amino-1,3-thiazol-4-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide?
The canonical SMILES for 2-(2-amino-1,3-thiazol-4-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide is CC(CCc1ccco1)NC(=O)Cc1csc(N)n1.
What is the InChIKey of 2-(2-amino-1,3-thiazol-4-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide?
The InChIKey is ZKEQOPLHHURIPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2S/c1-9(4-5-11-3-2-6-18-11)15-12(17)7-10-8-19-13(14)16-10/h2-3,6,8-9H,4-5,7H2,1H3,(H2,14,16)(H,15,17).
What are the key properties of 2-(2-amino-1,3-thiazol-4-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide?
2-(2-amino-1,3-thiazol-4-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide has a molecular weight of 279.37 g/mol, XLogP of 2.00, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-1,3-thiazol-4-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide is sourced from PubChem (CID 62799994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).