About cyclohexen-1-yl(1,4-dioxan-2-yl)methanone
cyclohexen-1-yl(1,4-dioxan-2-yl)methanone (PubChem CID 62800073) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is cyclohexen-1-yl(1,4-dioxan-2-yl)methanone.
Molecular Properties
| Compound Name | cyclohexen-1-yl(1,4-dioxan-2-yl)methanone |
| PubChem CID | 62800073 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | cyclohexen-1-yl(1,4-dioxan-2-yl)methanone |
| SMILES | O=C(C1=CCCCC1)C1COCCO1 |
| InChI | InChI=1S/C11H16O3/c12-11(9-4-2-1-3-5-9)10-8-13-6-7-14-10/h4,10H,1-3,5-8H2 |
| InChIKey | HRWVOTDOOJVLGZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexen-1-yl(1,4-dioxan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexen-1-yl(1,4-dioxan-2-yl)methanone?
The IUPAC name of cyclohexen-1-yl(1,4-dioxan-2-yl)methanone (CID 62800073) is cyclohexen-1-yl(1,4-dioxan-2-yl)methanone.
What is the SMILES notation for cyclohexen-1-yl(1,4-dioxan-2-yl)methanone?
The canonical SMILES for cyclohexen-1-yl(1,4-dioxan-2-yl)methanone is O=C(C1=CCCCC1)C1COCCO1.
What is the InChIKey of cyclohexen-1-yl(1,4-dioxan-2-yl)methanone?
The InChIKey is HRWVOTDOOJVLGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c12-11(9-4-2-1-3-5-9)10-8-13-6-7-14-10/h4,10H,1-3,5-8H2.
What are the key properties of cyclohexen-1-yl(1,4-dioxan-2-yl)methanone?
cyclohexen-1-yl(1,4-dioxan-2-yl)methanone has a molecular weight of 196.25 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexen-1-yl(1,4-dioxan-2-yl)methanone is sourced from PubChem (CID 62800073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).