About cyclopenten-1-yl(1,4-dioxan-2-yl)methanone
cyclopenten-1-yl(1,4-dioxan-2-yl)methanone (PubChem CID 62800074) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is cyclopenten-1-yl(1,4-dioxan-2-yl)methanone.
Molecular Properties
| Compound Name | cyclopenten-1-yl(1,4-dioxan-2-yl)methanone |
| PubChem CID | 62800074 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | cyclopenten-1-yl(1,4-dioxan-2-yl)methanone |
| SMILES | O=C(C1=CCCC1)C1COCCO1 |
| InChI | InChI=1S/C10H14O3/c11-10(8-3-1-2-4-8)9-7-12-5-6-13-9/h3,9H,1-2,4-7H2 |
| InChIKey | XUFZUSHXCPUDCP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopenten-1-yl(1,4-dioxan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenten-1-yl(1,4-dioxan-2-yl)methanone?
The IUPAC name of cyclopenten-1-yl(1,4-dioxan-2-yl)methanone (CID 62800074) is cyclopenten-1-yl(1,4-dioxan-2-yl)methanone.
What is the SMILES notation for cyclopenten-1-yl(1,4-dioxan-2-yl)methanone?
The canonical SMILES for cyclopenten-1-yl(1,4-dioxan-2-yl)methanone is O=C(C1=CCCC1)C1COCCO1.
What is the InChIKey of cyclopenten-1-yl(1,4-dioxan-2-yl)methanone?
The InChIKey is XUFZUSHXCPUDCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c11-10(8-3-1-2-4-8)9-7-12-5-6-13-9/h3,9H,1-2,4-7H2.
What are the key properties of cyclopenten-1-yl(1,4-dioxan-2-yl)methanone?
cyclopenten-1-yl(1,4-dioxan-2-yl)methanone has a molecular weight of 182.22 g/mol, XLogP of 1.08, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenten-1-yl(1,4-dioxan-2-yl)methanone is sourced from PubChem (CID 62800074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).