About 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-thiazole-4-carbaldehyde
2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-thiazole-4-carbaldehyde (PubChem CID 62800362) has the molecular formula C9H8N2OS2
and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-thiazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-thiazole-4-carbaldehyde |
| PubChem CID | 62800362 |
| Molecular Formula | C9H8N2OS2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-thiazole-4-carbaldehyde |
| SMILES | Cc1nc(Cc2nc(C=O)cs2)cs1 |
| InChI | InChI=1S/C9H8N2OS2/c1-6-10-7(4-13-6)2-9-11-8(3-12)5-14-9/h3-5H,2H2,1H3 |
| InChIKey | WLQHVQOZWVYVHH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-thiazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-thiazole-4-carbaldehyde?
The IUPAC name of 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-thiazole-4-carbaldehyde (CID 62800362) is 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-thiazole-4-carbaldehyde.
What is the SMILES notation for 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-thiazole-4-carbaldehyde?
The canonical SMILES for 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-thiazole-4-carbaldehyde is Cc1nc(Cc2nc(C=O)cs2)cs1.
What is the InChIKey of 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-thiazole-4-carbaldehyde?
The InChIKey is WLQHVQOZWVYVHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2OS2/c1-6-10-7(4-13-6)2-9-11-8(3-12)5-14-9/h3-5H,2H2,1H3.
What are the key properties of 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-thiazole-4-carbaldehyde?
2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-thiazole-4-carbaldehyde has a molecular weight of 224.31 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,3-thiazole-4-carbaldehyde is sourced from PubChem (CID 62800362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).