C13H9F2NO — CID 62800700
1-(3,4-difluorophenyl)-2-pyridin-3-ylethanone (PubChem CID 62800700) has the molecular formula C13H9F2NO and a molecular weight of 233.22 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-pyridin-3-ylethanone.
| Compound Name | 1-(3,4-difluorophenyl)-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 62800700 |
| Molecular Formula | C13H9F2NO |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-pyridin-3-ylethanone |
| SMILES | O=C(Cc1cccnc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H9F2NO/c14-11-4-3-10(7-12(11)15)13(17)6-9-2-1-5-16-8-9/h1-5,7-8H,6H2 |
| InChIKey | WMPHLKJXNFURNV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |