About 2-(3,5-difluorophenyl)cyclohexan-1-amine
2-(3,5-difluorophenyl)cyclohexan-1-amine (PubChem CID 62801272) has the molecular formula C12H15F2N
and a molecular weight of 211.25 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 2-(3,5-difluorophenyl)cyclohexan-1-amine |
| PubChem CID | 62801272 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-(3,5-difluorophenyl)cyclohexan-1-amine |
| SMILES | NC1CCCCC1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H15F2N/c13-9-5-8(6-10(14)7-9)11-3-1-2-4-12(11)15/h5-7,11-12H,1-4,15H2 |
| InChIKey | ILQBWRSKJMBYGF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,5-difluorophenyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-difluorophenyl)cyclohexan-1-amine?
The IUPAC name of 2-(3,5-difluorophenyl)cyclohexan-1-amine (CID 62801272) is 2-(3,5-difluorophenyl)cyclohexan-1-amine.
What is the SMILES notation for 2-(3,5-difluorophenyl)cyclohexan-1-amine?
The canonical SMILES for 2-(3,5-difluorophenyl)cyclohexan-1-amine is NC1CCCCC1c1cc(F)cc(F)c1.
What is the InChIKey of 2-(3,5-difluorophenyl)cyclohexan-1-amine?
The InChIKey is ILQBWRSKJMBYGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2N/c13-9-5-8(6-10(14)7-9)11-3-1-2-4-12(11)15/h5-7,11-12H,1-4,15H2.
What are the key properties of 2-(3,5-difluorophenyl)cyclohexan-1-amine?
2-(3,5-difluorophenyl)cyclohexan-1-amine has a molecular weight of 211.25 g/mol, XLogP of 2.95, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)cyclohexan-1-amine is sourced from PubChem (CID 62801272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).