About 1-cyclopropyl-1-(2,4-dimethylphenyl)ethanol
1-cyclopropyl-1-(2,4-dimethylphenyl)ethanol (PubChem CID 62801339) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-cyclopropyl-1-(2,4-dimethylphenyl)ethanol.
Molecular Properties
| Compound Name | 1-cyclopropyl-1-(2,4-dimethylphenyl)ethanol |
| PubChem CID | 62801339 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 1-cyclopropyl-1-(2,4-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(C(C)(O)C2CC2)c(C)c1 |
| InChI | InChI=1S/C13H18O/c1-9-4-7-12(10(2)8-9)13(3,14)11-5-6-11/h4,7-8,11,14H,5-6H2,1-3H3 |
| InChIKey | FKQZEYYELZXAJE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopropyl-1-(2,4-dimethylphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-1-(2,4-dimethylphenyl)ethanol?
The IUPAC name of 1-cyclopropyl-1-(2,4-dimethylphenyl)ethanol (CID 62801339) is 1-cyclopropyl-1-(2,4-dimethylphenyl)ethanol.
What is the SMILES notation for 1-cyclopropyl-1-(2,4-dimethylphenyl)ethanol?
The canonical SMILES for 1-cyclopropyl-1-(2,4-dimethylphenyl)ethanol is Cc1ccc(C(C)(O)C2CC2)c(C)c1.
What is the InChIKey of 1-cyclopropyl-1-(2,4-dimethylphenyl)ethanol?
The InChIKey is FKQZEYYELZXAJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-9-4-7-12(10(2)8-9)13(3,14)11-5-6-11/h4,7-8,11,14H,5-6H2,1-3H3.
What are the key properties of 1-cyclopropyl-1-(2,4-dimethylphenyl)ethanol?
1-cyclopropyl-1-(2,4-dimethylphenyl)ethanol has a molecular weight of 190.29 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-1-(2,4-dimethylphenyl)ethanol is sourced from PubChem (CID 62801339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).