About 1-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)ethanol
1-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)ethanol (PubChem CID 62801838) has the molecular formula C18H22O
and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)ethanol.
Molecular Properties
| Compound Name | 1-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)ethanol |
| PubChem CID | 62801838 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(C(C)(O)c2ccc(C)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C18H22O/c1-12-6-9-17(15(4)10-12)18(5,19)16-8-7-13(2)14(3)11-16/h6-11,19H,1-5H3 |
| InChIKey | OZIYWFRBUCFFJV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)ethanol?
The IUPAC name of 1-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)ethanol (CID 62801838) is 1-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)ethanol.
What is the SMILES notation for 1-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)ethanol?
The canonical SMILES for 1-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)ethanol is Cc1ccc(C(C)(O)c2ccc(C)c(C)c2)c(C)c1.
What is the InChIKey of 1-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)ethanol?
The InChIKey is OZIYWFRBUCFFJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O/c1-12-6-9-17(15(4)10-12)18(5,19)16-8-7-13(2)14(3)11-16/h6-11,19H,1-5H3.
What are the key properties of 1-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)ethanol?
1-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)ethanol has a molecular weight of 254.37 g/mol, XLogP of 4.18, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethylphenyl)-1-(3,4-dimethylphenyl)ethanol is sourced from PubChem (CID 62801838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).