C16H16F3N — CID 62801900
(4-propan-2-ylphenyl)-(3,4,5-trifluorophenyl)methanamine (PubChem CID 62801900) has the molecular formula C16H16F3N and a molecular weight of 279.31 g/mol. Its IUPAC name is (4-propan-2-ylphenyl)-(3,4,5-trifluorophenyl)methanamine.
| Compound Name | (4-propan-2-ylphenyl)-(3,4,5-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 62801900 |
| Molecular Formula | C16H16F3N |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (4-propan-2-ylphenyl)-(3,4,5-trifluorophenyl)methanamine |
| SMILES | CC(C)c1ccc(C(N)c2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H16F3N/c1-9(2)10-3-5-11(6-4-10)16(20)12-7-13(17)15(19)14(18)8-12/h3-9,16H,20H2,1-2H3 |
| InChIKey | BXVOFWVUEXIXGL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|