C14H11ClF2O — CID 62802085
1-(3-chlorophenyl)-1-(2,5-difluorophenyl)ethanol (PubChem CID 62802085) has the molecular formula C14H11ClF2O and a molecular weight of 268.69 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-1-(2,5-difluorophenyl)ethanol.
| Compound Name | 1-(3-chlorophenyl)-1-(2,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 62802085 |
| Molecular Formula | C14H11ClF2O |
| Molecular Weight | 268.69 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-(3-chlorophenyl)-1-(2,5-difluorophenyl)ethanol |
| SMILES | CC(O)(c1cccc(Cl)c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H11ClF2O/c1-14(18,9-3-2-4-10(15)7-9)12-8-11(16)5-6-13(12)17/h2-8,18H,1H3 |
| InChIKey | VNMPFVOPJVGJTA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |