About cyclopenten-1-yl(1,4-dioxan-2-yl)methanamine
cyclopenten-1-yl(1,4-dioxan-2-yl)methanamine (PubChem CID 62803470) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is cyclopenten-1-yl(1,4-dioxan-2-yl)methanamine.
Molecular Properties
| Compound Name | cyclopenten-1-yl(1,4-dioxan-2-yl)methanamine |
| PubChem CID | 62803470 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | cyclopenten-1-yl(1,4-dioxan-2-yl)methanamine |
| SMILES | NC(C1=CCCC1)C1COCCO1 |
| InChI | InChI=1S/C10H17NO2/c11-10(8-3-1-2-4-8)9-7-12-5-6-13-9/h3,9-10H,1-2,4-7,11H2 |
| InChIKey | JQTAALMSYUBKMP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclopenten-1-yl(1,4-dioxan-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenten-1-yl(1,4-dioxan-2-yl)methanamine?
The IUPAC name of cyclopenten-1-yl(1,4-dioxan-2-yl)methanamine (CID 62803470) is cyclopenten-1-yl(1,4-dioxan-2-yl)methanamine.
What is the SMILES notation for cyclopenten-1-yl(1,4-dioxan-2-yl)methanamine?
The canonical SMILES for cyclopenten-1-yl(1,4-dioxan-2-yl)methanamine is NC(C1=CCCC1)C1COCCO1.
What is the InChIKey of cyclopenten-1-yl(1,4-dioxan-2-yl)methanamine?
The InChIKey is JQTAALMSYUBKMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c11-10(8-3-1-2-4-8)9-7-12-5-6-13-9/h3,9-10H,1-2,4-7,11H2.
What are the key properties of cyclopenten-1-yl(1,4-dioxan-2-yl)methanamine?
cyclopenten-1-yl(1,4-dioxan-2-yl)methanamine has a molecular weight of 183.25 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenten-1-yl(1,4-dioxan-2-yl)methanamine is sourced from PubChem (CID 62803470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).