C13H13BrN2S — CID 62804634
4-[(3-bromophenyl)sulfanylmethyl]-N-methylpyridin-2-amine (PubChem CID 62804634) has the molecular formula C13H13BrN2S and a molecular weight of 309.23 g/mol. Its IUPAC name is 4-[(3-bromophenyl)sulfanylmethyl]-N-methylpyridin-2-amine.
| Compound Name | 4-[(3-bromophenyl)sulfanylmethyl]-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 62804634 |
| Molecular Formula | C13H13BrN2S |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 4-[(3-bromophenyl)sulfanylmethyl]-N-methylpyridin-2-amine |
| SMILES | CNc1cc(CSc2cccc(Br)c2)ccn1 |
| InChI | InChI=1S/C13H13BrN2S/c1-15-13-7-10(5-6-16-13)9-17-12-4-2-3-11(14)8-12/h2-8H,9H2,1H3,(H,15,16) |
| InChIKey | RQDZLAIOUZDXDM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |