About 2-[bromo-(2,4-dichlorophenyl)methyl]-1,4-dioxane
2-[bromo-(2,4-dichlorophenyl)methyl]-1,4-dioxane (PubChem CID 62805108) has the molecular formula C11H11BrCl2O2
and a molecular weight of 326.02 g/mol. Its IUPAC name is 2-[bromo-(2,4-dichlorophenyl)methyl]-1,4-dioxane.
Molecular Properties
| Compound Name | 2-[bromo-(2,4-dichlorophenyl)methyl]-1,4-dioxane |
| PubChem CID | 62805108 |
| Molecular Formula | C11H11BrCl2O2 |
| Molecular Weight | 326.02 g/mol |
| Exact Mass | 323.93 |
| IUPAC Name | 2-[bromo-(2,4-dichlorophenyl)methyl]-1,4-dioxane |
| SMILES | Clc1ccc(C(Br)C2COCCO2)c(Cl)c1 |
| InChI | InChI=1S/C11H11BrCl2O2/c12-11(10-6-15-3-4-16-10)8-2-1-7(13)5-9(8)14/h1-2,5,10-11H,3-4,6H2 |
| InChIKey | RYMQBMPPGNRICQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.02 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[bromo-(2,4-dichlorophenyl)methyl]-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bromo-(2,4-dichlorophenyl)methyl]-1,4-dioxane?
The IUPAC name of 2-[bromo-(2,4-dichlorophenyl)methyl]-1,4-dioxane (CID 62805108) is 2-[bromo-(2,4-dichlorophenyl)methyl]-1,4-dioxane.
What is the SMILES notation for 2-[bromo-(2,4-dichlorophenyl)methyl]-1,4-dioxane?
The canonical SMILES for 2-[bromo-(2,4-dichlorophenyl)methyl]-1,4-dioxane is Clc1ccc(C(Br)C2COCCO2)c(Cl)c1.
What is the InChIKey of 2-[bromo-(2,4-dichlorophenyl)methyl]-1,4-dioxane?
The InChIKey is RYMQBMPPGNRICQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrCl2O2/c12-11(10-6-15-3-4-16-10)8-2-1-7(13)5-9(8)14/h1-2,5,10-11H,3-4,6H2.
What are the key properties of 2-[bromo-(2,4-dichlorophenyl)methyl]-1,4-dioxane?
2-[bromo-(2,4-dichlorophenyl)methyl]-1,4-dioxane has a molecular weight of 326.02 g/mol, XLogP of 3.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bromo-(2,4-dichlorophenyl)methyl]-1,4-dioxane is sourced from PubChem (CID 62805108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).