About 5-methyl-4-(1,4-thiazepan-4-ylsulfonyl)furan-2-carboxylic acid
5-methyl-4-(1,4-thiazepan-4-ylsulfonyl)furan-2-carboxylic acid (PubChem CID 62805219) has the molecular formula C11H15NO5S2
and a molecular weight of 305.38 g/mol. Its IUPAC name is 5-methyl-4-(1,4-thiazepan-4-ylsulfonyl)furan-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-methyl-4-(1,4-thiazepan-4-ylsulfonyl)furan-2-carboxylic acid |
| PubChem CID | 62805219 |
| Molecular Formula | C11H15NO5S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 5-methyl-4-(1,4-thiazepan-4-ylsulfonyl)furan-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1S(=O)(=O)N1CCCSCC1 |
| InChI | InChI=1S/C11H15NO5S2/c1-8-10(7-9(17-8)11(13)14)19(15,16)12-3-2-5-18-6-4-12/h7H,2-6H2,1H3,(H,13,14) |
| InChIKey | KVVNWFBMCUZWHB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-4-(1,4-thiazepan-4-ylsulfonyl)furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-(1,4-thiazepan-4-ylsulfonyl)furan-2-carboxylic acid?
The IUPAC name of 5-methyl-4-(1,4-thiazepan-4-ylsulfonyl)furan-2-carboxylic acid (CID 62805219) is 5-methyl-4-(1,4-thiazepan-4-ylsulfonyl)furan-2-carboxylic acid.
What is the SMILES notation for 5-methyl-4-(1,4-thiazepan-4-ylsulfonyl)furan-2-carboxylic acid?
The canonical SMILES for 5-methyl-4-(1,4-thiazepan-4-ylsulfonyl)furan-2-carboxylic acid is Cc1oc(C(=O)O)cc1S(=O)(=O)N1CCCSCC1.
What is the InChIKey of 5-methyl-4-(1,4-thiazepan-4-ylsulfonyl)furan-2-carboxylic acid?
The InChIKey is KVVNWFBMCUZWHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO5S2/c1-8-10(7-9(17-8)11(13)14)19(15,16)12-3-2-5-18-6-4-12/h7H,2-6H2,1H3,(H,13,14).
What are the key properties of 5-methyl-4-(1,4-thiazepan-4-ylsulfonyl)furan-2-carboxylic acid?
5-methyl-4-(1,4-thiazepan-4-ylsulfonyl)furan-2-carboxylic acid has a molecular weight of 305.38 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-(1,4-thiazepan-4-ylsulfonyl)furan-2-carboxylic acid is sourced from PubChem (CID 62805219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).