C10H17N5O — CID 62807162
(3-amino-1H-1,2,4-triazol-5-yl)-(azocan-1-yl)methanone (PubChem CID 62807162) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is (3-amino-1H-1,2,4-triazol-5-yl)-(azocan-1-yl)methanone.
| Compound Name | (3-amino-1H-1,2,4-triazol-5-yl)-(azocan-1-yl)methanone |
|---|---|
| PubChem CID | 62807162 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (3-amino-1H-1,2,4-triazol-5-yl)-(azocan-1-yl)methanone |
| SMILES | Nc1n[nH]c(C(=O)N2CCCCCCC2)n1 |
| InChI | InChI=1S/C10H17N5O/c11-10-12-8(13-14-10)9(16)15-6-4-2-1-3-5-7-15/h1-7H2,(H3,11,12,13,14) |
| InChIKey | RECDVQHTTFLVLT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |