C6H4F3N5O2 — CID 62808221
4-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine (PubChem CID 62808221) has the molecular formula C6H4F3N5O2 and a molecular weight of 235.12 g/mol. Its IUPAC name is 4-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 62808221 |
| Molecular Formula | C6H4F3N5O2 |
| Molecular Weight | 235.12 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 4-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1-c1nc(CC(F)(F)F)no1 |
| InChI | InChI=1S/C6H4F3N5O2/c7-6(8,9)1-2-11-5(15-12-2)3-4(10)14-16-13-3/h1H2,(H2,10,14) |
| InChIKey | XEKBXGGWNFCVGX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.12 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |