C14H27N3O2 — CID 62808378
4-(aminomethyl)-N-methyl-N-[2-oxo-2-(propylamino)ethyl]cyclohexane-1-carboxamide (PubChem CID 62808378) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 4-(aminomethyl)-N-methyl-N-[2-oxo-2-(propylamino)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(aminomethyl)-N-methyl-N-[2-oxo-2-(propylamino)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 62808378 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 4-(aminomethyl)-N-methyl-N-[2-oxo-2-(propylamino)ethyl]cyclohexane-1-carboxamide |
| SMILES | CCCNC(=O)CN(C)C(=O)C1CCC(CN)CC1 |
| InChI | InChI=1S/C14H27N3O2/c1-3-8-16-13(18)10-17(2)14(19)12-6-4-11(9-15)5-7-12/h11-12H,3-10,15H2,1-2H3,(H,16,18) |
| InChIKey | FMUBTKHFAQIBBR-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |