C21H18ClF3N4O2 — CID 6280853
[(Z)-[amino-[4-(trifluoromethyl)phenyl]methylidene]amino] 1-(4-chlorophenyl)-5-propylpyrazole-4-carboxylate (PubChem CID 6280853) has the molecular formula C21H18ClF3N4O2 and a molecular weight of 450.85 g/mol. Its IUPAC name is [(Z)-[amino-[4-(trifluoromethyl)phenyl]methylidene]amino] 1-(4-chlorophenyl)-5-propylpyrazole-4-carboxylate.
| Compound Name | [(Z)-[amino-[4-(trifluoromethyl)phenyl]methylidene]amino] 1-(4-chlorophenyl)-5-propylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 6280853 |
| Molecular Formula | C21H18ClF3N4O2 |
| Molecular Weight | 450.85 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | [(Z)-[amino-[4-(trifluoromethyl)phenyl]methylidene]amino] 1-(4-chlorophenyl)-5-propylpyrazole-4-carboxylate |
| SMILES | CCCc1c(C(=O)O/N=C(\N)c2ccc(C(F)(F)F)cc2)cnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18ClF3N4O2/c1-2-3-18-17(12-27-29(18)16-10-8-15(22)9-11-16)20(30)31-28-19(26)13-4-6-14(7-5-13)21(23,24)25/h4-12H,2-3H2,1H3,(H2,26,28) |
| InChIKey | IQZKRATVRBJWRG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.85 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|