C12H10N6O3 — CID 62808582
3-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 62808582) has the molecular formula C12H10N6O3 and a molecular weight of 286.25 g/mol. Its IUPAC name is 3-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 62808582 |
| Molecular Formula | C12H10N6O3 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3-amino-N-(2-methyl-1,3-dioxoisoindol-5-yl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)c3nc(N)n[nH]3)cc2C1=O |
| InChI | InChI=1S/C12H10N6O3/c1-18-10(20)6-3-2-5(4-7(6)11(18)21)14-9(19)8-15-12(13)17-16-8/h2-4H,1H3,(H,14,19)(H3,13,15,16,17) |
| InChIKey | UGYRIRDNPLOJAQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|