C10H7NO4S — CID 6280959
(5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 6280959) has the molecular formula C10H7NO4S and a molecular weight of 237.24 g/mol. Its IUPAC name is (5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6280959 |
| Molecular Formula | C10H7NO4S |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.01 |
| IUPAC Name | (5Z)-5-[(2,4-dihydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(O)cc2O)S1 |
| InChI | InChI=1S/C10H7NO4S/c12-6-2-1-5(7(13)4-6)3-8-9(14)11-10(15)16-8/h1-4,12-13H,(H,11,14,15)/b8-3- |
| InChIKey | CPVBTHMWQGHRIR-BAQGIRSFSA-N |
| XLogP | 1.42 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|