About N-[(1-tert-butylpyrazol-4-yl)methyl]-2,3,5-trifluoroaniline
N-[(1-tert-butylpyrazol-4-yl)methyl]-2,3,5-trifluoroaniline (PubChem CID 62809630) has the molecular formula C14H16F3N3
and a molecular weight of 283.30 g/mol. Its IUPAC name is N-[(1-tert-butylpyrazol-4-yl)methyl]-2,3,5-trifluoroaniline.
Molecular Properties
| Compound Name | N-[(1-tert-butylpyrazol-4-yl)methyl]-2,3,5-trifluoroaniline |
| PubChem CID | 62809630 |
| Molecular Formula | C14H16F3N3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-[(1-tert-butylpyrazol-4-yl)methyl]-2,3,5-trifluoroaniline |
| SMILES | CC(C)(C)n1cc(CNc2cc(F)cc(F)c2F)cn1 |
| InChI | InChI=1S/C14H16F3N3/c1-14(2,3)20-8-9(7-19-20)6-18-12-5-10(15)4-11(16)13(12)17/h4-5,7-8,18H,6H2,1-3H3 |
| InChIKey | CYCJEFSAXOPRTK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(1-tert-butylpyrazol-4-yl)methyl]-2,3,5-trifluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-tert-butylpyrazol-4-yl)methyl]-2,3,5-trifluoroaniline?
The IUPAC name of N-[(1-tert-butylpyrazol-4-yl)methyl]-2,3,5-trifluoroaniline (CID 62809630) is N-[(1-tert-butylpyrazol-4-yl)methyl]-2,3,5-trifluoroaniline.
What is the SMILES notation for N-[(1-tert-butylpyrazol-4-yl)methyl]-2,3,5-trifluoroaniline?
The canonical SMILES for N-[(1-tert-butylpyrazol-4-yl)methyl]-2,3,5-trifluoroaniline is CC(C)(C)n1cc(CNc2cc(F)cc(F)c2F)cn1.
What is the InChIKey of N-[(1-tert-butylpyrazol-4-yl)methyl]-2,3,5-trifluoroaniline?
The InChIKey is CYCJEFSAXOPRTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F3N3/c1-14(2,3)20-8-9(7-19-20)6-18-12-5-10(15)4-11(16)13(12)17/h4-5,7-8,18H,6H2,1-3H3.
What are the key properties of N-[(1-tert-butylpyrazol-4-yl)methyl]-2,3,5-trifluoroaniline?
N-[(1-tert-butylpyrazol-4-yl)methyl]-2,3,5-trifluoroaniline has a molecular weight of 283.30 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-tert-butylpyrazol-4-yl)methyl]-2,3,5-trifluoroaniline is sourced from PubChem (CID 62809630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).