About N-but-2-ynyl-3,4,5-trifluoroaniline
N-but-2-ynyl-3,4,5-trifluoroaniline (PubChem CID 62809759) has the molecular formula C10H8F3N
and a molecular weight of 199.17 g/mol. Its IUPAC name is N-but-2-ynyl-3,4,5-trifluoroaniline.
Molecular Properties
| Compound Name | N-but-2-ynyl-3,4,5-trifluoroaniline |
| PubChem CID | 62809759 |
| Molecular Formula | C10H8F3N |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | N-but-2-ynyl-3,4,5-trifluoroaniline |
| SMILES | CC#CCNc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H8F3N/c1-2-3-4-14-7-5-8(11)10(13)9(12)6-7/h5-6,14H,4H2,1H3 |
| InChIKey | YLZJCEGUFWLWRF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-but-2-ynyl-3,4,5-trifluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-2-ynyl-3,4,5-trifluoroaniline?
The IUPAC name of N-but-2-ynyl-3,4,5-trifluoroaniline (CID 62809759) is N-but-2-ynyl-3,4,5-trifluoroaniline.
What is the SMILES notation for N-but-2-ynyl-3,4,5-trifluoroaniline?
The canonical SMILES for N-but-2-ynyl-3,4,5-trifluoroaniline is CC#CCNc1cc(F)c(F)c(F)c1.
What is the InChIKey of N-but-2-ynyl-3,4,5-trifluoroaniline?
The InChIKey is YLZJCEGUFWLWRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3N/c1-2-3-4-14-7-5-8(11)10(13)9(12)6-7/h5-6,14H,4H2,1H3.
What are the key properties of N-but-2-ynyl-3,4,5-trifluoroaniline?
N-but-2-ynyl-3,4,5-trifluoroaniline has a molecular weight of 199.17 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-2-ynyl-3,4,5-trifluoroaniline is sourced from PubChem (CID 62809759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).