C16H14F3N — CID 62810502
2,3,5-trifluoro-N-(3-phenylcyclobutyl)aniline (PubChem CID 62810502) has the molecular formula C16H14F3N and a molecular weight of 277.29 g/mol. Its IUPAC name is 2,3,5-trifluoro-N-(3-phenylcyclobutyl)aniline.
| Compound Name | 2,3,5-trifluoro-N-(3-phenylcyclobutyl)aniline |
|---|---|
| PubChem CID | 62810502 |
| Molecular Formula | C16H14F3N |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2,3,5-trifluoro-N-(3-phenylcyclobutyl)aniline |
| SMILES | Fc1cc(F)c(F)c(NC2CC(c3ccccc3)C2)c1 |
| InChI | InChI=1S/C16H14F3N/c17-12-8-14(18)16(19)15(9-12)20-13-6-11(7-13)10-4-2-1-3-5-10/h1-5,8-9,11,13,20H,6-7H2 |
| InChIKey | HCSQAPMZKBVHAL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|