About 2-(2,3,5-trifluoroanilino)acetonitrile
2-(2,3,5-trifluoroanilino)acetonitrile (PubChem CID 62810613) has the molecular formula C8H5F3N2
and a molecular weight of 186.14 g/mol. Its IUPAC name is 2-(2,3,5-trifluoroanilino)acetonitrile.
Molecular Properties
| Compound Name | 2-(2,3,5-trifluoroanilino)acetonitrile |
| PubChem CID | 62810613 |
| Molecular Formula | C8H5F3N2 |
| Molecular Weight | 186.14 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 2-(2,3,5-trifluoroanilino)acetonitrile |
| SMILES | N#CCNc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C8H5F3N2/c9-5-3-6(10)8(11)7(4-5)13-2-1-12/h3-4,13H,2H2 |
| InChIKey | LQWONXABSAZHLV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.14 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3,5-trifluoroanilino)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3,5-trifluoroanilino)acetonitrile?
The IUPAC name of 2-(2,3,5-trifluoroanilino)acetonitrile (CID 62810613) is 2-(2,3,5-trifluoroanilino)acetonitrile.
What is the SMILES notation for 2-(2,3,5-trifluoroanilino)acetonitrile?
The canonical SMILES for 2-(2,3,5-trifluoroanilino)acetonitrile is N#CCNc1cc(F)cc(F)c1F.
What is the InChIKey of 2-(2,3,5-trifluoroanilino)acetonitrile?
The InChIKey is LQWONXABSAZHLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3N2/c9-5-3-6(10)8(11)7(4-5)13-2-1-12/h3-4,13H,2H2.
What are the key properties of 2-(2,3,5-trifluoroanilino)acetonitrile?
2-(2,3,5-trifluoroanilino)acetonitrile has a molecular weight of 186.14 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3,5-trifluoroanilino)acetonitrile is sourced from PubChem (CID 62810613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).