About 3-(2,3,5-trifluoroanilino)butanenitrile
3-(2,3,5-trifluoroanilino)butanenitrile (PubChem CID 62811152) has the molecular formula C10H9F3N2
and a molecular weight of 214.19 g/mol. Its IUPAC name is 3-(2,3,5-trifluoroanilino)butanenitrile.
Molecular Properties
| Compound Name | 3-(2,3,5-trifluoroanilino)butanenitrile |
| PubChem CID | 62811152 |
| Molecular Formula | C10H9F3N2 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 3-(2,3,5-trifluoroanilino)butanenitrile |
| SMILES | CC(CC#N)Nc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C10H9F3N2/c1-6(2-3-14)15-9-5-7(11)4-8(12)10(9)13/h4-6,15H,2H2,1H3 |
| InChIKey | YHLRDLOSFVEQLT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3,5-trifluoroanilino)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3,5-trifluoroanilino)butanenitrile?
The IUPAC name of 3-(2,3,5-trifluoroanilino)butanenitrile (CID 62811152) is 3-(2,3,5-trifluoroanilino)butanenitrile.
What is the SMILES notation for 3-(2,3,5-trifluoroanilino)butanenitrile?
The canonical SMILES for 3-(2,3,5-trifluoroanilino)butanenitrile is CC(CC#N)Nc1cc(F)cc(F)c1F.
What is the InChIKey of 3-(2,3,5-trifluoroanilino)butanenitrile?
The InChIKey is YHLRDLOSFVEQLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N2/c1-6(2-3-14)15-9-5-7(11)4-8(12)10(9)13/h4-6,15H,2H2,1H3.
What are the key properties of 3-(2,3,5-trifluoroanilino)butanenitrile?
3-(2,3,5-trifluoroanilino)butanenitrile has a molecular weight of 214.19 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3,5-trifluoroanilino)butanenitrile is sourced from PubChem (CID 62811152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).