C14H7ClF4N2 — CID 62811846
2-(chloromethyl)-5-fluoro-1-(2,3,5-trifluorophenyl)benzimidazole (PubChem CID 62811846) has the molecular formula C14H7ClF4N2 and a molecular weight of 314.67 g/mol. Its IUPAC name is 2-(chloromethyl)-5-fluoro-1-(2,3,5-trifluorophenyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-5-fluoro-1-(2,3,5-trifluorophenyl)benzimidazole |
|---|---|
| PubChem CID | 62811846 |
| Molecular Formula | C14H7ClF4N2 |
| Molecular Weight | 314.67 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 2-(chloromethyl)-5-fluoro-1-(2,3,5-trifluorophenyl)benzimidazole |
| SMILES | Fc1cc(F)c(F)c(-n2c(CCl)nc3cc(F)ccc32)c1 |
| InChI | InChI=1S/C14H7ClF4N2/c15-6-13-20-10-4-7(16)1-2-11(10)21(13)12-5-8(17)3-9(18)14(12)19/h1-5H,6H2 |
| InChIKey | QUMVUQCEVNQNJL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.67 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|