C13H12F3N3 — CID 62812081
(5,6,8-trifluoro-1,2,3,4-tetrahydroacridin-9-yl)hydrazine (PubChem CID 62812081) has the molecular formula C13H12F3N3 and a molecular weight of 267.25 g/mol. Its IUPAC name is (5,6,8-trifluoro-1,2,3,4-tetrahydroacridin-9-yl)hydrazine.
| Compound Name | (5,6,8-trifluoro-1,2,3,4-tetrahydroacridin-9-yl)hydrazine |
|---|---|
| PubChem CID | 62812081 |
| Molecular Formula | C13H12F3N3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (5,6,8-trifluoro-1,2,3,4-tetrahydroacridin-9-yl)hydrazine |
| SMILES | NNc1c2c(nc3c(F)c(F)cc(F)c13)CCCC2 |
| InChI | InChI=1S/C13H12F3N3/c14-7-5-8(15)11(16)13-10(7)12(19-17)6-3-1-2-4-9(6)18-13/h5H,1-4,17H2,(H,18,19) |
| InChIKey | ZGMVULVJLICKMA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|