C13H9F3N2O2 — CID 62812163
1-(3,4,5-trifluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid (PubChem CID 62812163) has the molecular formula C13H9F3N2O2 and a molecular weight of 282.22 g/mol. Its IUPAC name is 1-(3,4,5-trifluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid.
| Compound Name | 1-(3,4,5-trifluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 62812163 |
| Molecular Formula | C13H9F3N2O2 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 1-(3,4,5-trifluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1nn(-c2cc(F)c(F)c(F)c2)c2c1CCC2 |
| InChI | InChI=1S/C13H9F3N2O2/c14-8-4-6(5-9(15)11(8)16)18-10-3-1-2-7(10)12(17-18)13(19)20/h4-5H,1-3H2,(H,19,20) |
| InChIKey | XTCDTYXELSOJCX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|