C14H10BrF3N2O — CID 62812529
4-bromo-1-cyclopropyl-N-(2,3,5-trifluorophenyl)pyrrole-2-carboxamide (PubChem CID 62812529) has the molecular formula C14H10BrF3N2O and a molecular weight of 359.15 g/mol. Its IUPAC name is 4-bromo-1-cyclopropyl-N-(2,3,5-trifluorophenyl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-cyclopropyl-N-(2,3,5-trifluorophenyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 62812529 |
| Molecular Formula | C14H10BrF3N2O |
| Molecular Weight | 359.15 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | 4-bromo-1-cyclopropyl-N-(2,3,5-trifluorophenyl)pyrrole-2-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1F)c1cc(Br)cn1C1CC1 |
| InChI | InChI=1S/C14H10BrF3N2O/c15-7-3-12(20(6-7)9-1-2-9)14(21)19-11-5-8(16)4-10(17)13(11)18/h3-6,9H,1-2H2,(H,19,21) |
| InChIKey | UXLVJMNUVMEXRD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.15 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|