C14H13F3N2 — CID 62812939
1-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydroindol-4-amine (PubChem CID 62812939) has the molecular formula C14H13F3N2 and a molecular weight of 266.27 g/mol. Its IUPAC name is 1-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydroindol-4-amine.
| Compound Name | 1-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydroindol-4-amine |
|---|---|
| PubChem CID | 62812939 |
| Molecular Formula | C14H13F3N2 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 1-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydroindol-4-amine |
| SMILES | NC1CCCc2c1ccn2-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H13F3N2/c15-10-6-8(7-11(16)14(10)17)19-5-4-9-12(18)2-1-3-13(9)19/h4-7,12H,1-3,18H2 |
| InChIKey | OLCVSJKITLGWMO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|