C14H12F3NO — CID 62813278
1-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydroindol-4-ol (PubChem CID 62813278) has the molecular formula C14H12F3NO and a molecular weight of 267.25 g/mol. Its IUPAC name is 1-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydroindol-4-ol.
| Compound Name | 1-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydroindol-4-ol |
|---|---|
| PubChem CID | 62813278 |
| Molecular Formula | C14H12F3NO |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydroindol-4-ol |
| SMILES | OC1CCCc2c1ccn2-c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H12F3NO/c15-10-6-8(7-11(16)14(10)17)18-5-4-9-12(18)2-1-3-13(9)19/h4-7,13,19H,1-3H2 |
| InChIKey | IHNIGRSETJKRHW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|