C8H3ClF3N3S — CID 62813440
4-chloro-N-(2,3,5-trifluorophenyl)-1,2,5-thiadiazol-3-amine (PubChem CID 62813440) has the molecular formula C8H3ClF3N3S and a molecular weight of 265.65 g/mol. Its IUPAC name is 4-chloro-N-(2,3,5-trifluorophenyl)-1,2,5-thiadiazol-3-amine.
| Compound Name | 4-chloro-N-(2,3,5-trifluorophenyl)-1,2,5-thiadiazol-3-amine |
|---|---|
| PubChem CID | 62813440 |
| Molecular Formula | C8H3ClF3N3S |
| Molecular Weight | 265.65 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | 4-chloro-N-(2,3,5-trifluorophenyl)-1,2,5-thiadiazol-3-amine |
| SMILES | Fc1cc(F)c(F)c(Nc2nsnc2Cl)c1 |
| InChI | InChI=1S/C8H3ClF3N3S/c9-7-8(15-16-14-7)13-5-2-3(10)1-4(11)6(5)12/h1-2H,(H,13,15) |
| InChIKey | WSTNSLXDSNGNKI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.65 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|