C8H4F3NO2 — CID 62813445
4,5,6-trifluoro-3-hydroxy-1,3-dihydroindol-2-one (PubChem CID 62813445) has the molecular formula C8H4F3NO2 and a molecular weight of 203.12 g/mol. Its IUPAC name is 4,5,6-trifluoro-3-hydroxy-1,3-dihydroindol-2-one.
| Compound Name | 4,5,6-trifluoro-3-hydroxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 62813445 |
| Molecular Formula | C8H4F3NO2 |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 4,5,6-trifluoro-3-hydroxy-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(F)c(F)c(F)c2C1O |
| InChI | InChI=1S/C8H4F3NO2/c9-2-1-3-4(6(11)5(2)10)7(13)8(14)12-3/h1,7,13H,(H,12,14) |
| InChIKey | UVGRHRHYXQWDMX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|