C15H16FNO — CID 62813453
1-(4-fluoro-3-methylphenyl)-4,5,6,7-tetrahydroindol-4-ol (PubChem CID 62813453) has the molecular formula C15H16FNO and a molecular weight of 245.30 g/mol. Its IUPAC name is 1-(4-fluoro-3-methylphenyl)-4,5,6,7-tetrahydroindol-4-ol.
| Compound Name | 1-(4-fluoro-3-methylphenyl)-4,5,6,7-tetrahydroindol-4-ol |
|---|---|
| PubChem CID | 62813453 |
| Molecular Formula | C15H16FNO |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-(4-fluoro-3-methylphenyl)-4,5,6,7-tetrahydroindol-4-ol |
| SMILES | Cc1cc(-n2ccc3c2CCCC3O)ccc1F |
| InChI | InChI=1S/C15H16FNO/c1-10-9-11(5-6-13(10)16)17-8-7-12-14(17)3-2-4-15(12)18/h5-9,15,18H,2-4H2,1H3 |
| InChIKey | ZEXOZIIJOALVLK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |